C18H24Cl2N2O2 — CID 119123831
N-[(6,8-dichloro-2H-chromen-3-yl)methyl]-3-morpholin-4-ylbutan-2-amine (PubChem CID 119123831) has the molecular formula C18H24Cl2N2O2 and a molecular weight of 371.31 g/mol. Its IUPAC name is N-[(6,8-dichloro-2H-chromen-3-yl)methyl]-3-morpholin-4-ylbutan-2-amine.
| Compound Name | N-[(6,8-dichloro-2H-chromen-3-yl)methyl]-3-morpholin-4-ylbutan-2-amine |
|---|---|
| PubChem CID | 119123831 |
| Molecular Formula | C18H24Cl2N2O2 |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | N-[(6,8-dichloro-2H-chromen-3-yl)methyl]-3-morpholin-4-ylbutan-2-amine |
| SMILES | CC(NCC1=Cc2cc(Cl)cc(Cl)c2OC1)C(C)N1CCOCC1 |
| InChI | InChI=1S/C18H24Cl2N2O2/c1-12(13(2)22-3-5-23-6-4-22)21-10-14-7-15-8-16(19)9-17(20)18(15)24-11-14/h7-9,12-13,21H,3-6,10-11H2,1-2H3 |
| InChIKey | FILQQWUYUIXCCF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |