C11H15ClO3S — CID 111469865
3-[(4-chlorophenyl)methylsulfonyl]-2-methylpropan-1-ol (PubChem CID 111469865) has the molecular formula C11H15ClO3S and a molecular weight of 262.76 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methylsulfonyl]-2-methylpropan-1-ol.
| Compound Name | 3-[(4-chlorophenyl)methylsulfonyl]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 111469865 |
| Molecular Formula | C11H15ClO3S |
| Molecular Weight | 262.76 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 3-[(4-chlorophenyl)methylsulfonyl]-2-methylpropan-1-ol |
| SMILES | CC(CO)CS(=O)(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H15ClO3S/c1-9(6-13)7-16(14,15)8-10-2-4-11(12)5-3-10/h2-5,9,13H,6-8H2,1H3 |
| InChIKey | CTDLBMQRVBWZQA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.76 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |