C15H19NO3 — CID 111470191
N-(3-hydroxybutyl)-5,6-dimethyl-1-benzofuran-2-carboxamide (PubChem CID 111470191) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is N-(3-hydroxybutyl)-5,6-dimethyl-1-benzofuran-2-carboxamide.
| Compound Name | N-(3-hydroxybutyl)-5,6-dimethyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 111470191 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | N-(3-hydroxybutyl)-5,6-dimethyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1cc2cc(C(=O)NCCC(C)O)oc2cc1C |
| InChI | InChI=1S/C15H19NO3/c1-9-6-12-8-14(19-13(12)7-10(9)2)15(18)16-5-4-11(3)17/h6-8,11,17H,4-5H2,1-3H3,(H,16,18) |
| InChIKey | LXYRJDRXQROXGD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |