C15H17NO4 — CID 119224238
2-[(5,6-dimethyl-1-benzofuran-2-carbonyl)amino]butanoic acid (PubChem CID 119224238) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is 2-[(5,6-dimethyl-1-benzofuran-2-carbonyl)amino]butanoic acid.
| Compound Name | 2-[(5,6-dimethyl-1-benzofuran-2-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 119224238 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2-[(5,6-dimethyl-1-benzofuran-2-carbonyl)amino]butanoic acid |
| SMILES | CCC(NC(=O)c1cc2cc(C)c(C)cc2o1)C(=O)O |
| InChI | InChI=1S/C15H17NO4/c1-4-11(15(18)19)16-14(17)13-7-10-5-8(2)9(3)6-12(10)20-13/h5-7,11H,4H2,1-3H3,(H,16,17)(H,18,19) |
| InChIKey | LHBCOCNEAVZGIK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |