C19H21NO2 — CID 111471582
N-(3-hydroxy-3-phenylpropyl)-2-phenylcyclopropane-1-carboxamide (PubChem CID 111471582) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is N-(3-hydroxy-3-phenylpropyl)-2-phenylcyclopropane-1-carboxamide.
| Compound Name | N-(3-hydroxy-3-phenylpropyl)-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 111471582 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | N-(3-hydroxy-3-phenylpropyl)-2-phenylcyclopropane-1-carboxamide |
| SMILES | O=C(NCCC(O)c1ccccc1)C1CC1c1ccccc1 |
| InChI | InChI=1S/C19H21NO2/c21-18(15-9-5-2-6-10-15)11-12-20-19(22)17-13-16(17)14-7-3-1-4-8-14/h1-10,16-18,21H,11-13H2,(H,20,22) |
| InChIKey | XWHIVFQIKXLMEA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |