C38H56N4O2 — CID 69221581
trans-(1R,2R)-N-[3-(cyclohexylamino)propyl]-2-phenylcyclopropane-1-carboxamide (PubChem CID 69221581) has the molecular formula C38H56N4O2 and a molecular weight of 600.89 g/mol. Its IUPAC name is trans-(1R,2R)-N-[3-(cyclohexylamino)propyl]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-[3-(cyclohexylamino)propyl]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 69221581 |
| Molecular Formula | C38H56N4O2 |
| Molecular Weight | 600.89 g/mol |
| Exact Mass | 600.44 |
| IUPAC Name | trans-(1R,2R)-N-[3-(cyclohexylamino)propyl]-2-phenylcyclopropane-1-carboxamide |
| SMILES | O=C(NCCCNC1CCCCC1)[C@@H]1C[C@H]1c1ccccc1.O=C(NCCCNC1CCCCC1)[C@@H]1C[C@H]1c1ccccc1 |
| InChI | InChI=1S/2C19H28N2O/c2*22-19(18-14-17(18)15-8-3-1-4-9-15)21-13-7-12-20-16-10-5-2-6-11-16/h2*1,3-4,8-9,16-18,20H,2,5-7,10-14H2,(H,21,22)/t2*17-,18+/m00/s1 |
| InChIKey | DURWKAUGTCEJOK-LRKRVMQJSA-N |
| XLogP | 6.44 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.89 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|