C13H18BrClN2O2 — CID 111473299
1-(4-bromo-2-chlorophenyl)-3-(1-hydroxy-4-methylpentan-3-yl)urea (PubChem CID 111473299) has the molecular formula C13H18BrClN2O2 and a molecular weight of 349.66 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-3-(1-hydroxy-4-methylpentan-3-yl)urea.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-3-(1-hydroxy-4-methylpentan-3-yl)urea |
|---|---|
| PubChem CID | 111473299 |
| Molecular Formula | C13H18BrClN2O2 |
| Molecular Weight | 349.66 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-3-(1-hydroxy-4-methylpentan-3-yl)urea |
| SMILES | CC(C)C(CCO)NC(=O)Nc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C13H18BrClN2O2/c1-8(2)11(5-6-18)16-13(19)17-12-4-3-9(14)7-10(12)15/h3-4,7-8,11,18H,5-6H2,1-2H3,(H2,16,17,19) |
| InChIKey | WNKYQHSSFYKDIF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.66 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |