C19H28N4O2 — CID 111473587
1-(2-benzyl-5-methylpyrazol-3-yl)-3-(4-hydroxy-2,2-dimethylpentyl)urea (PubChem CID 111473587) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 1-(2-benzyl-5-methylpyrazol-3-yl)-3-(4-hydroxy-2,2-dimethylpentyl)urea.
| Compound Name | 1-(2-benzyl-5-methylpyrazol-3-yl)-3-(4-hydroxy-2,2-dimethylpentyl)urea |
|---|---|
| PubChem CID | 111473587 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 1-(2-benzyl-5-methylpyrazol-3-yl)-3-(4-hydroxy-2,2-dimethylpentyl)urea |
| SMILES | Cc1cc(NC(=O)NCC(C)(C)CC(C)O)n(Cc2ccccc2)n1 |
| InChI | InChI=1S/C19H28N4O2/c1-14-10-17(23(22-14)12-16-8-6-5-7-9-16)21-18(25)20-13-19(3,4)11-15(2)24/h5-10,15,24H,11-13H2,1-4H3,(H2,20,21,25) |
| InChIKey | YYWVAFIROICMSU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |