C18H27N5O2 — CID 111473770
1-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-3-(5-hydroxy-4,4-dimethylpentyl)urea (PubChem CID 111473770) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is 1-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-3-(5-hydroxy-4,4-dimethylpentyl)urea.
| Compound Name | 1-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-3-(5-hydroxy-4,4-dimethylpentyl)urea |
|---|---|
| PubChem CID | 111473770 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 1-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-3-(5-hydroxy-4,4-dimethylpentyl)urea |
| SMILES | Cc1cc(C)n(-c2ccc(NC(=O)NCCCC(C)(C)CO)cn2)n1 |
| InChI | InChI=1S/C18H27N5O2/c1-13-10-14(2)23(22-13)16-7-6-15(11-20-16)21-17(25)19-9-5-8-18(3,4)12-24/h6-7,10-11,24H,5,8-9,12H2,1-4H3,(H2,19,21,25) |
| InChIKey | VULGTRHYTMRMGJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|