C19H20N6O3 — CID 46436330
N-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-3-(2-nitroanilino)propanamide (PubChem CID 46436330) has the molecular formula C19H20N6O3 and a molecular weight of 380.41 g/mol. Its IUPAC name is N-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-3-(2-nitroanilino)propanamide.
| Compound Name | N-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-3-(2-nitroanilino)propanamide |
|---|---|
| PubChem CID | 46436330 |
| Molecular Formula | C19H20N6O3 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | N-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-3-(2-nitroanilino)propanamide |
| SMILES | Cc1cc(C)n(-c2ccc(NC(=O)CCNc3ccccc3[N+](=O)[O-])cn2)n1 |
| InChI | InChI=1S/C19H20N6O3/c1-13-11-14(2)24(23-13)18-8-7-15(12-21-18)22-19(26)9-10-20-16-5-3-4-6-17(16)25(27)28/h3-8,11-12,20H,9-10H2,1-2H3,(H,22,26) |
| InChIKey | XECUXTDDXKYCCO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|