C20H16N6O5 — CID 31908039
N-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 31908039) has the molecular formula C20H16N6O5 and a molecular weight of 420.39 g/mol. Its IUPAC name is N-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 31908039 |
| Molecular Formula | C20H16N6O5 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | N-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | Cc1cc(C)n(-c2ccc(NC(=O)CN3C(=O)c4cccc([N+](=O)[O-])c4C3=O)cn2)n1 |
| InChI | InChI=1S/C20H16N6O5/c1-11-8-12(2)25(23-11)16-7-6-13(9-21-16)22-17(27)10-24-19(28)14-4-3-5-15(26(30)31)18(14)20(24)29/h3-9H,10H2,1-2H3,(H,22,27) |
| InChIKey | WWDGWHYAGNNGNX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 140.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|