C22H20N6O5 — CID 56531790
N-(3-tert-butyl-1-pyridin-2-ylpyrazol-5-yl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 56531790) has the molecular formula C22H20N6O5 and a molecular weight of 448.44 g/mol. Its IUPAC name is N-(3-tert-butyl-1-pyridin-2-ylpyrazol-5-yl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-(3-tert-butyl-1-pyridin-2-ylpyrazol-5-yl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 56531790 |
| Molecular Formula | C22H20N6O5 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | N-(3-tert-butyl-1-pyridin-2-ylpyrazol-5-yl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | CC(C)(C)c1cc(NC(=O)CN2C(=O)c3cccc([N+](=O)[O-])c3C2=O)n(-c2ccccn2)n1 |
| InChI | InChI=1S/C22H20N6O5/c1-22(2,3)15-11-17(27(25-15)16-9-4-5-10-23-16)24-18(29)12-26-20(30)13-7-6-8-14(28(32)33)19(13)21(26)31/h4-11H,12H2,1-3H3,(H,24,29) |
| InChIKey | BTBWNWKGERYUPQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 140.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|