C20H26N2O3 — CID 111473999
1-(4-hydroxy-2,2-dimethylbutyl)-3-[2-(phenoxymethyl)phenyl]urea (PubChem CID 111473999) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-(4-hydroxy-2,2-dimethylbutyl)-3-[2-(phenoxymethyl)phenyl]urea.
| Compound Name | 1-(4-hydroxy-2,2-dimethylbutyl)-3-[2-(phenoxymethyl)phenyl]urea |
|---|---|
| PubChem CID | 111473999 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 1-(4-hydroxy-2,2-dimethylbutyl)-3-[2-(phenoxymethyl)phenyl]urea |
| SMILES | CC(C)(CCO)CNC(=O)Nc1ccccc1COc1ccccc1 |
| InChI | InChI=1S/C20H26N2O3/c1-20(2,12-13-23)15-21-19(24)22-18-11-7-6-8-16(18)14-25-17-9-4-3-5-10-17/h3-11,23H,12-15H2,1-2H3,(H2,21,22,24) |
| InChIKey | XWTXAQWZLCIOPE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |