C15H23N5O2S — CID 111475357
1-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]-3-(2-hydroxy-2-thiophen-3-ylpropyl)urea (PubChem CID 111475357) has the molecular formula C15H23N5O2S and a molecular weight of 337.45 g/mol. Its IUPAC name is 1-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]-3-(2-hydroxy-2-thiophen-3-ylpropyl)urea.
| Compound Name | 1-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]-3-(2-hydroxy-2-thiophen-3-ylpropyl)urea |
|---|---|
| PubChem CID | 111475357 |
| Molecular Formula | C15H23N5O2S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 1-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]-3-(2-hydroxy-2-thiophen-3-ylpropyl)urea |
| SMILES | CN(C)CCn1ccc(NC(=O)NCC(C)(O)c2ccsc2)n1 |
| InChI | InChI=1S/C15H23N5O2S/c1-15(22,12-5-9-23-10-12)11-16-14(21)17-13-4-6-20(18-13)8-7-19(2)3/h4-6,9-10,22H,7-8,11H2,1-3H3,(H2,16,17,18,21) |
| InChIKey | OSVNTIHNOFHHCX-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 82.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |