C14H27N5O2 — CID 111475349
1-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]-3-(2-hydroxy-4-methylpentyl)urea (PubChem CID 111475349) has the molecular formula C14H27N5O2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 1-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]-3-(2-hydroxy-4-methylpentyl)urea.
| Compound Name | 1-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]-3-(2-hydroxy-4-methylpentyl)urea |
|---|---|
| PubChem CID | 111475349 |
| Molecular Formula | C14H27N5O2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | 1-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]-3-(2-hydroxy-4-methylpentyl)urea |
| SMILES | CC(C)CC(O)CNC(=O)Nc1ccn(CCN(C)C)n1 |
| InChI | InChI=1S/C14H27N5O2/c1-11(2)9-12(20)10-15-14(21)16-13-5-6-19(17-13)8-7-18(3)4/h5-6,11-12,20H,7-10H2,1-4H3,(H2,15,16,17,21) |
| InChIKey | NPTYIJVLPLTDPN-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 82.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |