C14H29Cl2N5O — CID 119870128
7-amino-N-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]heptanamide;dihydrochloride (PubChem CID 119870128) has the molecular formula C14H29Cl2N5O and a molecular weight of 354.33 g/mol. Its IUPAC name is 7-amino-N-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]heptanamide;dihydrochloride.
| Compound Name | 7-amino-N-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]heptanamide;dihydrochloride |
|---|---|
| PubChem CID | 119870128 |
| Molecular Formula | C14H29Cl2N5O |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 7-amino-N-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]heptanamide;dihydrochloride |
| SMILES | CN(C)CCn1ccc(NC(=O)CCCCCCN)n1.Cl.Cl |
| InChI | InChI=1S/C14H27N5O.2ClH/c1-18(2)11-12-19-10-8-13(17-19)16-14(20)7-5-3-4-6-9-15;;/h8,10H,3-7,9,11-12,15H2,1-2H3,(H,16,17,20);2*1H |
| InChIKey | SOGACJANCPQZKA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|