C16H31Cl2N5O — CID 119870176
N-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]-3-piperidin-4-ylbutanamide;dihydrochloride (PubChem CID 119870176) has the molecular formula C16H31Cl2N5O and a molecular weight of 380.36 g/mol. Its IUPAC name is N-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]-3-piperidin-4-ylbutanamide;dihydrochloride.
| Compound Name | N-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]-3-piperidin-4-ylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 119870176 |
| Molecular Formula | C16H31Cl2N5O |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]-3-piperidin-4-ylbutanamide;dihydrochloride |
| SMILES | CC(CC(=O)Nc1ccn(CCN(C)C)n1)C1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H29N5O.2ClH/c1-13(14-4-7-17-8-5-14)12-16(22)18-15-6-9-21(19-15)11-10-20(2)3;;/h6,9,13-14,17H,4-5,7-8,10-12H2,1-3H3,(H,18,19,22);2*1H |
| InChIKey | ARLBQJOTLHRUNW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |