C12H25Cl2N5O — CID 120565170
4-amino-N-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]pentanamide;dihydrochloride (PubChem CID 120565170) has the molecular formula C12H25Cl2N5O and a molecular weight of 326.27 g/mol. Its IUPAC name is 4-amino-N-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]pentanamide;dihydrochloride.
| Compound Name | 4-amino-N-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]pentanamide;dihydrochloride |
|---|---|
| PubChem CID | 120565170 |
| Molecular Formula | C12H25Cl2N5O |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 4-amino-N-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]pentanamide;dihydrochloride |
| SMILES | CC(N)CCC(=O)Nc1ccn(CCN(C)C)n1.Cl.Cl |
| InChI | InChI=1S/C12H23N5O.2ClH/c1-10(13)4-5-12(18)14-11-6-7-17(15-11)9-8-16(2)3;;/h6-7,10H,4-5,8-9,13H2,1-3H3,(H,14,15,18);2*1H |
| InChIKey | LQLRNAGWPBMSFL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |