About 3-amino-N-[1-(2,2-difluoroethyl)pyrazol-3-yl]propanamide;hydrochloride
3-amino-N-[1-(2,2-difluoroethyl)pyrazol-3-yl]propanamide;hydrochloride (PubChem CID 119341237) has the molecular formula C8H13ClF2N4O
and a molecular weight of 254.67 g/mol. Its IUPAC name is 3-amino-N-[1-(2,2-difluoroethyl)pyrazol-3-yl]propanamide;hydrochloride.
Molecular Properties
| Compound Name | 3-amino-N-[1-(2,2-difluoroethyl)pyrazol-3-yl]propanamide;hydrochloride |
| PubChem CID | 119341237 |
| Molecular Formula | C8H13ClF2N4O |
| Molecular Weight | 254.67 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 3-amino-N-[1-(2,2-difluoroethyl)pyrazol-3-yl]propanamide;hydrochloride |
| SMILES | Cl.NCCC(=O)Nc1ccn(CC(F)F)n1 |
| InChI | InChI=1S/C8H12F2N4O.ClH/c9-6(10)5-14-4-2-7(13-14)12-8(15)1-3-11;/h2,4,6H,1,3,5,11H2,(H,12,13,15);1H |
| InChIKey | YFAXCPNIAALDGK-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.67 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-N-[1-(2,2-difluoroethyl)pyrazol-3-yl]propanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-[1-(2,2-difluoroethyl)pyrazol-3-yl]propanamide;hydrochloride?
The IUPAC name of 3-amino-N-[1-(2,2-difluoroethyl)pyrazol-3-yl]propanamide;hydrochloride (CID 119341237) is 3-amino-N-[1-(2,2-difluoroethyl)pyrazol-3-yl]propanamide;hydrochloride.
What is the SMILES notation for 3-amino-N-[1-(2,2-difluoroethyl)pyrazol-3-yl]propanamide;hydrochloride?
The canonical SMILES for 3-amino-N-[1-(2,2-difluoroethyl)pyrazol-3-yl]propanamide;hydrochloride is Cl.NCCC(=O)Nc1ccn(CC(F)F)n1.
What is the InChIKey of 3-amino-N-[1-(2,2-difluoroethyl)pyrazol-3-yl]propanamide;hydrochloride?
The InChIKey is YFAXCPNIAALDGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F2N4O.ClH/c9-6(10)5-14-4-2-7(13-14)12-8(15)1-3-11;/h2,4,6H,1,3,5,11H2,(H,12,13,15);1H.
What are the key properties of 3-amino-N-[1-(2,2-difluoroethyl)pyrazol-3-yl]propanamide;hydrochloride?
3-amino-N-[1-(2,2-difluoroethyl)pyrazol-3-yl]propanamide;hydrochloride has a molecular weight of 254.67 g/mol, XLogP of 0.86, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-[1-(2,2-difluoroethyl)pyrazol-3-yl]propanamide;hydrochloride is sourced from PubChem (CID 119341237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).