C18H27N5O2 — CID 111475375
1-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]-3-(4-hydroxy-1-phenylbutyl)urea (PubChem CID 111475375) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is 1-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]-3-(4-hydroxy-1-phenylbutyl)urea.
| Compound Name | 1-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]-3-(4-hydroxy-1-phenylbutyl)urea |
|---|---|
| PubChem CID | 111475375 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 1-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]-3-(4-hydroxy-1-phenylbutyl)urea |
| SMILES | CN(C)CCn1ccc(NC(=O)NC(CCCO)c2ccccc2)n1 |
| InChI | InChI=1S/C18H27N5O2/c1-22(2)12-13-23-11-10-17(21-23)20-18(25)19-16(9-6-14-24)15-7-4-3-5-8-15/h3-5,7-8,10-11,16,24H,6,9,12-14H2,1-2H3,(H2,19,20,21,25) |
| InChIKey | ANVMSVUNZVYBCC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 82.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |