C15H23N5O2 — CID 99794112
1-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]-3-[(1R)-1-[(3R)-oxolan-3-yl]prop-2-ynyl]urea (PubChem CID 99794112) has the molecular formula C15H23N5O2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 1-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]-3-[(1R)-1-[(3R)-oxolan-3-yl]prop-2-ynyl]urea.
| Compound Name | 1-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]-3-[(1R)-1-[(3R)-oxolan-3-yl]prop-2-ynyl]urea |
|---|---|
| PubChem CID | 99794112 |
| Molecular Formula | C15H23N5O2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 1-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]-3-[(1R)-1-[(3R)-oxolan-3-yl]prop-2-ynyl]urea |
| SMILES | C#C[C@H](NC(=O)Nc1ccn(CCN(C)C)n1)[C@H]1CCOC1 |
| InChI | InChI=1S/C15H23N5O2/c1-4-13(12-6-10-22-11-12)16-15(21)17-14-5-7-20(18-14)9-8-19(2)3/h1,5,7,12-13H,6,8-11H2,2-3H3,(H2,16,17,18,21)/t12-,13-/m0/s1 |
| InChIKey | SXNLZKHWOQOVNZ-STQMWFEESA-N |
| XLogP | 0.60 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|