C15H25N5O2 — CID 167806834
(3aS,7aS)-N-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-3a-carboxamide (PubChem CID 167806834) has the molecular formula C15H25N5O2 and a molecular weight of 307.40 g/mol. Its IUPAC name is (3aS,7aS)-N-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-3a-carboxamide.
| Compound Name | (3aS,7aS)-N-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 167806834 |
| Molecular Formula | C15H25N5O2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | (3aS,7aS)-N-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-3a-carboxamide |
| SMILES | CN(C)CCn1ccc(NC(=O)[C@]23CNC[C@H]2CCOC3)n1 |
| InChI | InChI=1S/C15H25N5O2/c1-19(2)6-7-20-5-3-13(18-20)17-14(21)15-10-16-9-12(15)4-8-22-11-15/h3,5,12,16H,4,6-11H2,1-2H3,(H,17,18,21)/t12-,15+/m1/s1 |
| InChIKey | ROJOPUVPIXNIEH-DOMZBBRYSA-N |
| XLogP | 0.01 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |