C10H15F3N2O2 — CID 167785947
(3aS,7aS)-N-(2,2,2-trifluoroethyl)-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-3a-carboxamide (PubChem CID 167785947) has the molecular formula C10H15F3N2O2 and a molecular weight of 252.24 g/mol. Its IUPAC name is (3aS,7aS)-N-(2,2,2-trifluoroethyl)-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-3a-carboxamide.
| Compound Name | (3aS,7aS)-N-(2,2,2-trifluoroethyl)-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 167785947 |
| Molecular Formula | C10H15F3N2O2 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | (3aS,7aS)-N-(2,2,2-trifluoroethyl)-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-3a-carboxamide |
| SMILES | O=C(NCC(F)(F)F)[C@]12CNC[C@H]1CCOC2 |
| InChI | InChI=1S/C10H15F3N2O2/c11-10(12,13)5-15-8(16)9-4-14-3-7(9)1-2-17-6-9/h7,14H,1-6H2,(H,15,16)/t7-,9+/m1/s1 |
| InChIKey | NGEBJBXEHMIUQQ-APPZFPTMSA-N |
| XLogP | 0.29 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |