C13H23N3O4S — CID 138014909
[(3aS,7aS)-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-3a-yl]-(4-methylsulfonylpiperazin-1-yl)methanone (PubChem CID 138014909) has the molecular formula C13H23N3O4S and a molecular weight of 317.41 g/mol. Its IUPAC name is [(3aS,7aS)-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-3a-yl]-(4-methylsulfonylpiperazin-1-yl)methanone.
| Compound Name | [(3aS,7aS)-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-3a-yl]-(4-methylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 138014909 |
| Molecular Formula | C13H23N3O4S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | [(3aS,7aS)-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-3a-yl]-(4-methylsulfonylpiperazin-1-yl)methanone |
| SMILES | CS(=O)(=O)N1CCN(C(=O)[C@]23CNC[C@H]2CCOC3)CC1 |
| InChI | InChI=1S/C13H23N3O4S/c1-21(18,19)16-5-3-15(4-6-16)12(17)13-9-14-8-11(13)2-7-20-10-13/h11,14H,2-10H2,1H3/t11-,13+/m1/s1 |
| InChIKey | IPLLSZCNUSSWRT-YPMHNXCESA-N |
| XLogP | -1.28 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |