C11H22ClN3O4S — CID 119696186
1-(4-methylsulfonylpiperazin-1-yl)-2-morpholin-2-ylethanone;hydrochloride (PubChem CID 119696186) has the molecular formula C11H22ClN3O4S and a molecular weight of 327.83 g/mol. Its IUPAC name is 1-(4-methylsulfonylpiperazin-1-yl)-2-morpholin-2-ylethanone;hydrochloride.
| Compound Name | 1-(4-methylsulfonylpiperazin-1-yl)-2-morpholin-2-ylethanone;hydrochloride |
|---|---|
| PubChem CID | 119696186 |
| Molecular Formula | C11H22ClN3O4S |
| Molecular Weight | 327.83 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 1-(4-methylsulfonylpiperazin-1-yl)-2-morpholin-2-ylethanone;hydrochloride |
| SMILES | CS(=O)(=O)N1CCN(C(=O)CC2CNCCO2)CC1.Cl |
| InChI | InChI=1S/C11H21N3O4S.ClH/c1-19(16,17)14-5-3-13(4-6-14)11(15)8-10-9-12-2-7-18-10;/h10,12H,2-9H2,1H3;1H |
| InChIKey | KAQFVOMUFJDJAY-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.83 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |