C13H23N3O3 — CID 66433581
N-methyl-1-(2-morpholin-2-ylacetyl)piperidine-4-carboxamide (PubChem CID 66433581) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is N-methyl-1-(2-morpholin-2-ylacetyl)piperidine-4-carboxamide.
| Compound Name | N-methyl-1-(2-morpholin-2-ylacetyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 66433581 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | N-methyl-1-(2-morpholin-2-ylacetyl)piperidine-4-carboxamide |
| SMILES | CNC(=O)C1CCN(C(=O)CC2CNCCO2)CC1 |
| InChI | InChI=1S/C13H23N3O3/c1-14-13(18)10-2-5-16(6-3-10)12(17)8-11-9-15-4-7-19-11/h10-11,15H,2-9H2,1H3,(H,14,18) |
| InChIKey | XQAPLDAGBOPJMO-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |