C13H23N3O5S — CID 124952648
(6S)-1-methylsulfonyl-4-(oxane-4-carbonyl)-1,4-diazepane-6-carboxamide (PubChem CID 124952648) has the molecular formula C13H23N3O5S and a molecular weight of 333.41 g/mol. Its IUPAC name is (6S)-1-methylsulfonyl-4-(oxane-4-carbonyl)-1,4-diazepane-6-carboxamide.
| Compound Name | (6S)-1-methylsulfonyl-4-(oxane-4-carbonyl)-1,4-diazepane-6-carboxamide |
|---|---|
| PubChem CID | 124952648 |
| Molecular Formula | C13H23N3O5S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | (6S)-1-methylsulfonyl-4-(oxane-4-carbonyl)-1,4-diazepane-6-carboxamide |
| SMILES | CS(=O)(=O)N1CCN(C(=O)C2CCOCC2)C[C@H](C(N)=O)C1 |
| InChI | InChI=1S/C13H23N3O5S/c1-22(19,20)16-5-4-15(8-11(9-16)12(14)17)13(18)10-2-6-21-7-3-10/h10-11H,2-9H2,1H3,(H2,14,17)/t11-/m0/s1 |
| InChIKey | DQAFQRWVOTZABN-NSHDSACASA-N |
| XLogP | -1.38 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |