C10H19N3O5S — CID 127245306
1-(2-methoxyacetyl)-4-methylsulfonyl-1,4-diazepane-6-carboxamide (PubChem CID 127245306) has the molecular formula C10H19N3O5S and a molecular weight of 293.35 g/mol. Its IUPAC name is 1-(2-methoxyacetyl)-4-methylsulfonyl-1,4-diazepane-6-carboxamide.
| Compound Name | 1-(2-methoxyacetyl)-4-methylsulfonyl-1,4-diazepane-6-carboxamide |
|---|---|
| PubChem CID | 127245306 |
| Molecular Formula | C10H19N3O5S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 1-(2-methoxyacetyl)-4-methylsulfonyl-1,4-diazepane-6-carboxamide |
| SMILES | COCC(=O)N1CCN(S(C)(=O)=O)CC(C(N)=O)C1 |
| InChI | InChI=1S/C10H19N3O5S/c1-18-7-9(14)12-3-4-13(19(2,16)17)6-8(5-12)10(11)15/h8H,3-7H2,1-2H3,(H2,11,15) |
| InChIKey | CTBJEFAAZWYMCO-UHFFFAOYSA-N |
| XLogP | -2.16 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |