C13H25N3O4S — CID 127247881
1-ethylsulfonyl-4-(oxan-4-yl)-1,4-diazepane-6-carboxamide (PubChem CID 127247881) has the molecular formula C13H25N3O4S and a molecular weight of 319.43 g/mol. Its IUPAC name is 1-ethylsulfonyl-4-(oxan-4-yl)-1,4-diazepane-6-carboxamide.
| Compound Name | 1-ethylsulfonyl-4-(oxan-4-yl)-1,4-diazepane-6-carboxamide |
|---|---|
| PubChem CID | 127247881 |
| Molecular Formula | C13H25N3O4S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 1-ethylsulfonyl-4-(oxan-4-yl)-1,4-diazepane-6-carboxamide |
| SMILES | CCS(=O)(=O)N1CCN(C2CCOCC2)CC(C(N)=O)C1 |
| InChI | InChI=1S/C13H25N3O4S/c1-2-21(18,19)16-6-5-15(9-11(10-16)13(14)17)12-3-7-20-8-4-12/h11-12H,2-10H2,1H3,(H2,14,17) |
| InChIKey | KVEOCCUNDWEIHG-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |