C15H22N4O2 — CID 100697344
1-(1-tert-butylpyrazol-4-yl)-3-[(1S)-1-[(3R)-oxolan-3-yl]prop-2-ynyl]urea (PubChem CID 100697344) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 1-(1-tert-butylpyrazol-4-yl)-3-[(1S)-1-[(3R)-oxolan-3-yl]prop-2-ynyl]urea.
| Compound Name | 1-(1-tert-butylpyrazol-4-yl)-3-[(1S)-1-[(3R)-oxolan-3-yl]prop-2-ynyl]urea |
|---|---|
| PubChem CID | 100697344 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 1-(1-tert-butylpyrazol-4-yl)-3-[(1S)-1-[(3R)-oxolan-3-yl]prop-2-ynyl]urea |
| SMILES | C#C[C@@H](NC(=O)Nc1cnn(C(C)(C)C)c1)[C@H]1CCOC1 |
| InChI | InChI=1S/C15H22N4O2/c1-5-13(11-6-7-21-10-11)18-14(20)17-12-8-16-19(9-12)15(2,3)4/h1,8-9,11,13H,6-7,10H2,2-4H3,(H2,17,18,20)/t11-,13+/m0/s1 |
| InChIKey | ZUZUZOHCQGYINE-WCQYABFASA-N |
| XLogP | 1.80 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|