C18H19FN4O2 — CID 99794108
1-[3-fluoro-4-(4-methylpyrazol-1-yl)phenyl]-3-[(1R)-1-[(3R)-oxolan-3-yl]prop-2-ynyl]urea (PubChem CID 99794108) has the molecular formula C18H19FN4O2 and a molecular weight of 342.37 g/mol. Its IUPAC name is 1-[3-fluoro-4-(4-methylpyrazol-1-yl)phenyl]-3-[(1R)-1-[(3R)-oxolan-3-yl]prop-2-ynyl]urea.
| Compound Name | 1-[3-fluoro-4-(4-methylpyrazol-1-yl)phenyl]-3-[(1R)-1-[(3R)-oxolan-3-yl]prop-2-ynyl]urea |
|---|---|
| PubChem CID | 99794108 |
| Molecular Formula | C18H19FN4O2 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 1-[3-fluoro-4-(4-methylpyrazol-1-yl)phenyl]-3-[(1R)-1-[(3R)-oxolan-3-yl]prop-2-ynyl]urea |
| SMILES | C#C[C@H](NC(=O)Nc1ccc(-n2cc(C)cn2)c(F)c1)[C@H]1CCOC1 |
| InChI | InChI=1S/C18H19FN4O2/c1-3-16(13-6-7-25-11-13)22-18(24)21-14-4-5-17(15(19)8-14)23-10-12(2)9-20-23/h1,4-5,8-10,13,16H,6-7,11H2,2H3,(H2,21,22,24)/t13-,16-/m0/s1 |
| InChIKey | UKIANJJRTJKMSY-BBRMVZONSA-N |
| XLogP | 2.48 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|