C19H25FN4O2 — CID 43074830
1-[1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]-3-[1-(oxolan-2-yl)ethyl]urea (PubChem CID 43074830) has the molecular formula C19H25FN4O2 and a molecular weight of 360.43 g/mol. Its IUPAC name is 1-[1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]-3-[1-(oxolan-2-yl)ethyl]urea.
| Compound Name | 1-[1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]-3-[1-(oxolan-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 43074830 |
| Molecular Formula | C19H25FN4O2 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 1-[1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]-3-[1-(oxolan-2-yl)ethyl]urea |
| SMILES | Cc1c(C(C)NC(=O)NC(C)C2CCCO2)cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C19H25FN4O2/c1-12(22-19(25)23-13(2)18-5-4-10-26-18)17-11-21-24(14(17)3)16-8-6-15(20)7-9-16/h6-9,11-13,18H,4-5,10H2,1-3H3,(H2,22,23,25) |
| InChIKey | ULCRRQLLMMVSES-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |