C16H21N5O2 — CID 71984813
1-methyl-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]-1-(pyridin-4-ylmethyl)urea (PubChem CID 71984813) has the molecular formula C16H21N5O2 and a molecular weight of 315.38 g/mol. Its IUPAC name is 1-methyl-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]-1-(pyridin-4-ylmethyl)urea.
| Compound Name | 1-methyl-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]-1-(pyridin-4-ylmethyl)urea |
|---|---|
| PubChem CID | 71984813 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 1-methyl-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]-1-(pyridin-4-ylmethyl)urea |
| SMILES | CN(Cc1ccncc1)C(=O)Nc1cnn(CC2CCCO2)c1 |
| InChI | InChI=1S/C16H21N5O2/c1-20(10-13-4-6-17-7-5-13)16(22)19-14-9-18-21(11-14)12-15-3-2-8-23-15/h4-7,9,11,15H,2-3,8,10,12H2,1H3,(H,19,22) |
| InChIKey | LYICYUROIVSXQH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |