C20H33N3O2 — CID 111477879
4-(4-ethylpiperazin-1-yl)-N-(2-hydroxy-2,3-dimethylpentyl)benzamide (PubChem CID 111477879) has the molecular formula C20H33N3O2 and a molecular weight of 347.50 g/mol. Its IUPAC name is 4-(4-ethylpiperazin-1-yl)-N-(2-hydroxy-2,3-dimethylpentyl)benzamide.
| Compound Name | 4-(4-ethylpiperazin-1-yl)-N-(2-hydroxy-2,3-dimethylpentyl)benzamide |
|---|---|
| PubChem CID | 111477879 |
| Molecular Formula | C20H33N3O2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | 4-(4-ethylpiperazin-1-yl)-N-(2-hydroxy-2,3-dimethylpentyl)benzamide |
| SMILES | CCC(C)C(C)(O)CNC(=O)c1ccc(N2CCN(CC)CC2)cc1 |
| InChI | InChI=1S/C20H33N3O2/c1-5-16(3)20(4,25)15-21-19(24)17-7-9-18(10-8-17)23-13-11-22(6-2)12-14-23/h7-10,16,25H,5-6,11-15H2,1-4H3,(H,21,24) |
| InChIKey | SLNLWKZJIQQCDL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |