C18H25N3O2 — CID 111446448
N-(2-hydroxy-2,3-dimethylpentyl)-4-(4-methylpyrazol-1-yl)benzamide (PubChem CID 111446448) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is N-(2-hydroxy-2,3-dimethylpentyl)-4-(4-methylpyrazol-1-yl)benzamide.
| Compound Name | N-(2-hydroxy-2,3-dimethylpentyl)-4-(4-methylpyrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 111446448 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | N-(2-hydroxy-2,3-dimethylpentyl)-4-(4-methylpyrazol-1-yl)benzamide |
| SMILES | CCC(C)C(C)(O)CNC(=O)c1ccc(-n2cc(C)cn2)cc1 |
| InChI | InChI=1S/C18H25N3O2/c1-5-14(3)18(4,23)12-19-17(22)15-6-8-16(9-7-15)21-11-13(2)10-20-21/h6-11,14,23H,5,12H2,1-4H3,(H,19,22) |
| InChIKey | PCOBVECLVVGMKZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |