C14H19N3O2 — CID 111480323
5-cyano-N-(4-hydroxy-2,2-dimethylpentyl)pyridine-2-carboxamide (PubChem CID 111480323) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 5-cyano-N-(4-hydroxy-2,2-dimethylpentyl)pyridine-2-carboxamide.
| Compound Name | 5-cyano-N-(4-hydroxy-2,2-dimethylpentyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 111480323 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 5-cyano-N-(4-hydroxy-2,2-dimethylpentyl)pyridine-2-carboxamide |
| SMILES | CC(O)CC(C)(C)CNC(=O)c1ccc(C#N)cn1 |
| InChI | InChI=1S/C14H19N3O2/c1-10(18)6-14(2,3)9-17-13(19)12-5-4-11(7-15)8-16-12/h4-5,8,10,18H,6,9H2,1-3H3,(H,17,19) |
| InChIKey | GZHBNTAURNKSBC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |