C16H22FN3O2 — CID 111482961
1-[(5-cyano-2-fluorophenyl)methyl]-3-(3-ethyl-2-hydroxypentyl)urea (PubChem CID 111482961) has the molecular formula C16H22FN3O2 and a molecular weight of 307.37 g/mol. Its IUPAC name is 1-[(5-cyano-2-fluorophenyl)methyl]-3-(3-ethyl-2-hydroxypentyl)urea.
| Compound Name | 1-[(5-cyano-2-fluorophenyl)methyl]-3-(3-ethyl-2-hydroxypentyl)urea |
|---|---|
| PubChem CID | 111482961 |
| Molecular Formula | C16H22FN3O2 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 1-[(5-cyano-2-fluorophenyl)methyl]-3-(3-ethyl-2-hydroxypentyl)urea |
| SMILES | CCC(CC)C(O)CNC(=O)NCc1cc(C#N)ccc1F |
| InChI | InChI=1S/C16H22FN3O2/c1-3-12(4-2)15(21)10-20-16(22)19-9-13-7-11(8-18)5-6-14(13)17/h5-7,12,15,21H,3-4,9-10H2,1-2H3,(H2,19,20,22) |
| InChIKey | SMKKGVSJOGUTMY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |