C15H20F2N2O3 — CID 111483465
N-[2-[(2-ethyl-2-hydroxybutyl)amino]-2-oxoethyl]-3,5-difluorobenzamide (PubChem CID 111483465) has the molecular formula C15H20F2N2O3 and a molecular weight of 314.33 g/mol. Its IUPAC name is N-[2-[(2-ethyl-2-hydroxybutyl)amino]-2-oxoethyl]-3,5-difluorobenzamide.
| Compound Name | N-[2-[(2-ethyl-2-hydroxybutyl)amino]-2-oxoethyl]-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 111483465 |
| Molecular Formula | C15H20F2N2O3 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | N-[2-[(2-ethyl-2-hydroxybutyl)amino]-2-oxoethyl]-3,5-difluorobenzamide |
| SMILES | CCC(O)(CC)CNC(=O)CNC(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C15H20F2N2O3/c1-3-15(22,4-2)9-19-13(20)8-18-14(21)10-5-11(16)7-12(17)6-10/h5-7,22H,3-4,8-9H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | AMJPKFQVHQSANK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |