C9H14O5 — CID 11148362
methyl (2Z)-2-[(3S,4R)-3,4-dimethoxyoxolan-2-ylidene]acetate (PubChem CID 11148362) has the molecular formula C9H14O5 and a molecular weight of 202.21 g/mol. Its IUPAC name is methyl (2Z)-2-[(3S,4R)-3,4-dimethoxyoxolan-2-ylidene]acetate.
| Compound Name | methyl (2Z)-2-[(3S,4R)-3,4-dimethoxyoxolan-2-ylidene]acetate |
|---|---|
| PubChem CID | 11148362 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | methyl (2Z)-2-[(3S,4R)-3,4-dimethoxyoxolan-2-ylidene]acetate |
| SMILES | COC(=O)/C=C1\OC[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C9H14O5/c1-11-7-5-14-6(9(7)13-3)4-8(10)12-2/h4,7,9H,5H2,1-3H3/b6-4-/t7-,9-/m1/s1 |
| InChIKey | QQIZFMWYQPTMOR-NOFMJIGPSA-N |
| XLogP | 0.10 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|