C16H22N2O2 — CID 111484272
N-(2-hydroxy-2,3-dimethylbutyl)-6-methyl-1H-indole-2-carboxamide (PubChem CID 111484272) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is N-(2-hydroxy-2,3-dimethylbutyl)-6-methyl-1H-indole-2-carboxamide.
| Compound Name | N-(2-hydroxy-2,3-dimethylbutyl)-6-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 111484272 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-(2-hydroxy-2,3-dimethylbutyl)-6-methyl-1H-indole-2-carboxamide |
| SMILES | Cc1ccc2cc(C(=O)NCC(C)(O)C(C)C)[nH]c2c1 |
| InChI | InChI=1S/C16H22N2O2/c1-10(2)16(4,20)9-17-15(19)14-8-12-6-5-11(3)7-13(12)18-14/h5-8,10,18,20H,9H2,1-4H3,(H,17,19) |
| InChIKey | MMPXBCZZNKGZRF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |