C18H26N4O — CID 56823834
6-methyl-N-[2-(4-methylpiperazin-1-yl)propyl]-1H-indole-2-carboxamide (PubChem CID 56823834) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is 6-methyl-N-[2-(4-methylpiperazin-1-yl)propyl]-1H-indole-2-carboxamide.
| Compound Name | 6-methyl-N-[2-(4-methylpiperazin-1-yl)propyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 56823834 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 6-methyl-N-[2-(4-methylpiperazin-1-yl)propyl]-1H-indole-2-carboxamide |
| SMILES | Cc1ccc2cc(C(=O)NCC(C)N3CCN(C)CC3)[nH]c2c1 |
| InChI | InChI=1S/C18H26N4O/c1-13-4-5-15-11-17(20-16(15)10-13)18(23)19-12-14(2)22-8-6-21(3)7-9-22/h4-5,10-11,14,20H,6-9,12H2,1-3H3,(H,19,23) |
| InChIKey | KHCANILYZIIECW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |