C20H23N3OS — CID 39988576
5-methyl-N-[(2S)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]-1H-indole-2-carboxamide (PubChem CID 39988576) has the molecular formula C20H23N3OS and a molecular weight of 353.49 g/mol. Its IUPAC name is 5-methyl-N-[(2S)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]-1H-indole-2-carboxamide.
| Compound Name | 5-methyl-N-[(2S)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 39988576 |
| Molecular Formula | C20H23N3OS |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 5-methyl-N-[(2S)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]-1H-indole-2-carboxamide |
| SMILES | Cc1ccc2[nH]c(C(=O)NC[C@@H](c3cccs3)N3CCCC3)cc2c1 |
| InChI | InChI=1S/C20H23N3OS/c1-14-6-7-16-15(11-14)12-17(22-16)20(24)21-13-18(19-5-4-10-25-19)23-8-2-3-9-23/h4-7,10-12,18,22H,2-3,8-9,13H2,1H3,(H,21,24)/t18-/m0/s1 |
| InChIKey | SQDUCOXAOMYZQA-SFHVURJKSA-N |
| XLogP | 4.10 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |