C18H24N2O3S — CID 111484704
3-[(dimethylamino)methyl]-N-[(4-hydroxythian-4-yl)methyl]-1-benzofuran-2-carboxamide (PubChem CID 111484704) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is 3-[(dimethylamino)methyl]-N-[(4-hydroxythian-4-yl)methyl]-1-benzofuran-2-carboxamide.
| Compound Name | 3-[(dimethylamino)methyl]-N-[(4-hydroxythian-4-yl)methyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 111484704 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 3-[(dimethylamino)methyl]-N-[(4-hydroxythian-4-yl)methyl]-1-benzofuran-2-carboxamide |
| SMILES | CN(C)Cc1c(C(=O)NCC2(O)CCSCC2)oc2ccccc12 |
| InChI | InChI=1S/C18H24N2O3S/c1-20(2)11-14-13-5-3-4-6-15(13)23-16(14)17(21)19-12-18(22)7-9-24-10-8-18/h3-6,22H,7-12H2,1-2H3,(H,19,21) |
| InChIKey | MZPVCGLBDOZUBI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |