C21H23N3O5 — CID 86600353
N-[2-(2-carbamoyl-4-hydroxyphenoxy)ethyl]-3-[(dimethylamino)methyl]-1-benzofuran-2-carboxamide (PubChem CID 86600353) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is N-[2-(2-carbamoyl-4-hydroxyphenoxy)ethyl]-3-[(dimethylamino)methyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-(2-carbamoyl-4-hydroxyphenoxy)ethyl]-3-[(dimethylamino)methyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 86600353 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | N-[2-(2-carbamoyl-4-hydroxyphenoxy)ethyl]-3-[(dimethylamino)methyl]-1-benzofuran-2-carboxamide |
| SMILES | CN(C)Cc1c(C(=O)NCCOc2ccc(O)cc2C(N)=O)oc2ccccc12 |
| InChI | InChI=1S/C21H23N3O5/c1-24(2)12-16-14-5-3-4-6-18(14)29-19(16)21(27)23-9-10-28-17-8-7-13(25)11-15(17)20(22)26/h3-8,11,25H,9-10,12H2,1-2H3,(H2,22,26)(H,23,27) |
| InChIKey | VPBOCHFZXIZNQW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 118.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|