C22H25N3O5 — CID 167213495
3-[(dimethylamino)methyl]-N-[2-[5-(hydroxycarbamoyl)cyclohepta-1,4,6-trien-1-yl]oxyethyl]-1-benzofuran-2-carboxamide (PubChem CID 167213495) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is 3-[(dimethylamino)methyl]-N-[2-[5-(hydroxycarbamoyl)cyclohepta-1,4,6-trien-1-yl]oxyethyl]-1-benzofuran-2-carboxamide.
| Compound Name | 3-[(dimethylamino)methyl]-N-[2-[5-(hydroxycarbamoyl)cyclohepta-1,4,6-trien-1-yl]oxyethyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 167213495 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 3-[(dimethylamino)methyl]-N-[2-[5-(hydroxycarbamoyl)cyclohepta-1,4,6-trien-1-yl]oxyethyl]-1-benzofuran-2-carboxamide |
| SMILES | CN(C)Cc1c(C(=O)NCCOC2=CCC=C(C(=O)NO)C=C2)oc2ccccc12 |
| InChI | InChI=1S/C22H25N3O5/c1-25(2)14-18-17-8-3-4-9-19(17)30-20(18)22(27)23-12-13-29-16-7-5-6-15(10-11-16)21(26)24-28/h3-4,6-11,28H,5,12-14H2,1-2H3,(H,23,27)(H,24,26) |
| InChIKey | VXIPGVVDKOIUAU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 104.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|