C22H24N2O6 — CID 91317388
N-[2-(2-carbamoylphenoxy)ethyl]-3-(3-hydroxypropoxymethyl)-1-benzofuran-2-carboxamide (PubChem CID 91317388) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is N-[2-(2-carbamoylphenoxy)ethyl]-3-(3-hydroxypropoxymethyl)-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-(2-carbamoylphenoxy)ethyl]-3-(3-hydroxypropoxymethyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 91317388 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N-[2-(2-carbamoylphenoxy)ethyl]-3-(3-hydroxypropoxymethyl)-1-benzofuran-2-carboxamide |
| SMILES | NC(=O)c1ccccc1OCCNC(=O)c1oc2ccccc2c1COCCCO |
| InChI | InChI=1S/C22H24N2O6/c23-21(26)16-7-2-3-8-18(16)29-13-10-24-22(27)20-17(14-28-12-5-11-25)15-6-1-4-9-19(15)30-20/h1-4,6-9,25H,5,10-14H2,(H2,23,26)(H,24,27) |
| InChIKey | HUACKDAZNOYXMN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 124.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|