C40H50N2O14 — CID 157314859
[(2R,3S,4S,5R,6R)-6-[2-[4-[2-[[3-[(dimethylamino)methyl]-1-benzofuran-2-carbonyl]amino]ethoxy]phenyl]-2-oxoethoxy]-3,4,5-tri(propanoyloxy)oxan-2-yl]methyl propanoate (PubChem CID 157314859) has the molecular formula C40H50N2O14 and a molecular weight of 782.84 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-6-[2-[4-[2-[[3-[(dimethylamino)methyl]-1-benzofuran-2-carbonyl]amino]ethoxy]phenyl]-2-oxoethoxy]-3,4,5-tri(propanoyloxy)oxan-2-yl]methyl propanoate.
| Compound Name | [(2R,3S,4S,5R,6R)-6-[2-[4-[2-[[3-[(dimethylamino)methyl]-1-benzofuran-2-carbonyl]amino]ethoxy]phenyl]-2-oxoethoxy]-3,4,5-tri(propanoyloxy)oxan-2-yl]methyl propanoate |
|---|---|
| PubChem CID | 157314859 |
| Molecular Formula | C40H50N2O14 |
| Molecular Weight | 782.84 g/mol |
| Exact Mass | 782.33 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-6-[2-[4-[2-[[3-[(dimethylamino)methyl]-1-benzofuran-2-carbonyl]amino]ethoxy]phenyl]-2-oxoethoxy]-3,4,5-tri(propanoyloxy)oxan-2-yl]methyl propanoate |
| SMILES | CCC(=O)OC[C@H]1O[C@@H](OCC(=O)c2ccc(OCCNC(=O)c3oc4ccccc4c3CN(C)C)cc2)[C@H](OC(=O)CC)[C@@H](OC(=O)CC)[C@H]1OC(=O)CC |
| InChI | InChI=1S/C40H50N2O14/c1-7-31(44)50-23-30-36(54-32(45)8-2)37(55-33(46)9-3)38(56-34(47)10-4)40(53-30)51-22-28(43)24-15-17-25(18-16-24)49-20-19-41-39(48)35-27(21-42(5)6)26-13-11-12-14-29(26)52-35/h11-18,30,36-38,40H,7-10,19-23H2,1-6H3,(H,41,48)/t30-,36+,37+,38-,40-/m1/s1 |
| InChIKey | NAKCFSGXTYKZTE-TYJVBCFHSA-N |
| XLogP | 4.15 |
| TPSA | 195.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.84 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|