C21H22N4O7 — CID 87108320
3-[[[2-(hydroxyamino)-2-oxoethyl]amino]methyl]-N-[2-[4-(hydroxycarbamoyl)phenoxy]ethyl]-1-benzofuran-2-carboxamide (PubChem CID 87108320) has the molecular formula C21H22N4O7 and a molecular weight of 442.43 g/mol. Its IUPAC name is 3-[[[2-(hydroxyamino)-2-oxoethyl]amino]methyl]-N-[2-[4-(hydroxycarbamoyl)phenoxy]ethyl]-1-benzofuran-2-carboxamide.
| Compound Name | 3-[[[2-(hydroxyamino)-2-oxoethyl]amino]methyl]-N-[2-[4-(hydroxycarbamoyl)phenoxy]ethyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 87108320 |
| Molecular Formula | C21H22N4O7 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 3-[[[2-(hydroxyamino)-2-oxoethyl]amino]methyl]-N-[2-[4-(hydroxycarbamoyl)phenoxy]ethyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(CNCc1c(C(=O)NCCOc2ccc(C(=O)NO)cc2)oc2ccccc12)NO |
| InChI | InChI=1S/C21H22N4O7/c26-18(24-29)12-22-11-16-15-3-1-2-4-17(15)32-19(16)21(28)23-9-10-31-14-7-5-13(6-8-14)20(27)25-30/h1-8,22,29-30H,9-12H2,(H,23,28)(H,24,26)(H,25,27) |
| InChIKey | LEEXPLSIPDZRNT-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 162.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|