C25H19F3N2O6 — CID 87871102
N-[2-[4-(hydroxycarbamoyl)phenoxy]ethyl]-3-[2-(trifluoromethoxy)phenyl]-1-benzofuran-2-carboxamide (PubChem CID 87871102) has the molecular formula C25H19F3N2O6 and a molecular weight of 500.43 g/mol. Its IUPAC name is N-[2-[4-(hydroxycarbamoyl)phenoxy]ethyl]-3-[2-(trifluoromethoxy)phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-[4-(hydroxycarbamoyl)phenoxy]ethyl]-3-[2-(trifluoromethoxy)phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 87871102 |
| Molecular Formula | C25H19F3N2O6 |
| Molecular Weight | 500.43 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | N-[2-[4-(hydroxycarbamoyl)phenoxy]ethyl]-3-[2-(trifluoromethoxy)phenyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NO)c1ccc(OCCNC(=O)c2oc3ccccc3c2-c2ccccc2OC(F)(F)F)cc1 |
| InChI | InChI=1S/C25H19F3N2O6/c26-25(27,28)36-20-8-4-2-6-18(20)21-17-5-1-3-7-19(17)35-22(21)24(32)29-13-14-34-16-11-9-15(10-12-16)23(31)30-33/h1-12,33H,13-14H2,(H,29,32)(H,30,31) |
| InChIKey | MGNYOMNAGGKTHF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 110.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|