C27H23F3N2O4S — CID 42646722
N-[2-[4-(hydroxycarbamothioyl)phenoxy]ethyl]-3-[2-[3-(trifluoromethyl)phenyl]ethyl]-1-benzofuran-2-carboxamide (PubChem CID 42646722) has the molecular formula C27H23F3N2O4S and a molecular weight of 528.55 g/mol. Its IUPAC name is N-[2-[4-(hydroxycarbamothioyl)phenoxy]ethyl]-3-[2-[3-(trifluoromethyl)phenyl]ethyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-[4-(hydroxycarbamothioyl)phenoxy]ethyl]-3-[2-[3-(trifluoromethyl)phenyl]ethyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 42646722 |
| Molecular Formula | C27H23F3N2O4S |
| Molecular Weight | 528.55 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | N-[2-[4-(hydroxycarbamothioyl)phenoxy]ethyl]-3-[2-[3-(trifluoromethyl)phenyl]ethyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCCOc1ccc(C(=S)NO)cc1)c1oc2ccccc2c1CCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H23F3N2O4S/c28-27(29,30)19-5-3-4-17(16-19)8-13-22-21-6-1-2-7-23(21)36-24(22)25(33)31-14-15-35-20-11-9-18(10-12-20)26(37)32-34/h1-7,9-12,16,34H,8,13-15H2,(H,31,33)(H,32,37) |
| InChIKey | BIDZIGIETJJOEQ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.55 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|